C19H27NO5 — CID 67174968
(5S,6S,7S,7aS)-6,7-dihydroxy-5-(6-phenylmethoxyhexyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 67174968) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is (5S,6S,7S,7aS)-6,7-dihydroxy-5-(6-phenylmethoxyhexyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (5S,6S,7S,7aS)-6,7-dihydroxy-5-(6-phenylmethoxyhexyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 67174968 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (5S,6S,7S,7aS)-6,7-dihydroxy-5-(6-phenylmethoxyhexyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | O=C1OC[C@H]2[C@H](O)[C@@H](O)[C@H](CCCCCCOCc3ccccc3)N12 |
| InChI | InChI=1S/C19H27NO5/c21-17-15(20-16(18(17)22)13-25-19(20)23)10-6-1-2-7-11-24-12-14-8-4-3-5-9-14/h3-5,8-9,15-18,21-22H,1-2,6-7,10-13H2/t15-,16-,17-,18-/m0/s1 |
| InChIKey | YOSTXSDDKRVIDJ-XSLAGTTESA-N |
| XLogP | 2.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|