C16H19NO4 — CID 23730409
(2R,3S,5S,6S,7R)-2-ethyl-6-phenylmethoxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one (PubChem CID 23730409) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R,3S,5S,6S,7R)-2-ethyl-6-phenylmethoxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one.
| Compound Name | (2R,3S,5S,6S,7R)-2-ethyl-6-phenylmethoxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one |
|---|---|
| PubChem CID | 23730409 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R,3S,5S,6S,7R)-2-ethyl-6-phenylmethoxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one |
| SMILES | CC[C@@H]1[C@@H]2O[C@@H]2[C@@H](OCc2ccccc2)[C@H]2COC(=O)N21 |
| InChI | InChI=1S/C16H19NO4/c1-2-11-14-15(21-14)13(12-9-20-16(18)17(11)12)19-8-10-6-4-3-5-7-10/h3-7,11-15H,2,8-9H2,1H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | MQCLRHCRJVCABB-NIFZNCRKSA-N |
| XLogP | 1.95 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|