C21H22O6 — CID 126961884
(1R,2R,3R,4S,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid (PubChem CID 126961884) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4S,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 126961884 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (1R,2R,3R,4S,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C21H22O6/c22-16-15(21(23)24)17-20(27-17)19(26-12-14-9-5-2-6-10-14)18(16)25-11-13-7-3-1-4-8-13/h1-10,15-20,22H,11-12H2,(H,23,24)/t15-,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | XJLKSVZNKLQJIH-IGOIZDSHSA-N |
| XLogP | 2.00 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|