C35H36O5 — CID 137325219
(1R,2R,3S,4S,5R,6R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane (PubChem CID 137325219) has the molecular formula C35H36O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,6R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1R,2R,3S,4S,5R,6R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 137325219 |
| Molecular Formula | C35H36O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (1R,2R,3S,4S,5R,6R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-7-oxabicyclo[4.1.0]heptane |
| SMILES | c1ccc(COC[C@@H]2C(OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]3O[C@@H]32)cc1 |
| InChI | InChI=1S/C35H36O5/c1-5-13-26(14-6-1)21-36-25-30-31(37-22-27-15-7-2-8-16-27)33(38-23-28-17-9-3-10-18-28)34(35-32(30)40-35)39-24-29-19-11-4-12-20-29/h1-20,30-35H,21-25H2/t30-,31?,32-,33+,34-,35-/m1/s1 |
| InChIKey | PKJGRYPOGBPCAQ-WNENKMDHSA-N |
| XLogP | 6.36 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|