C14H18O2 — CID 135039485
trans-(1R,2R)-2-(3-phenylmethoxypropyl)cyclopropane-1-carbaldehyde (PubChem CID 135039485) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-phenylmethoxypropyl)cyclopropane-1-carbaldehyde.
| Compound Name | trans-(1R,2R)-2-(3-phenylmethoxypropyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 135039485 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | trans-(1R,2R)-2-(3-phenylmethoxypropyl)cyclopropane-1-carbaldehyde |
| SMILES | O=C[C@@H]1C[C@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C14H18O2/c15-10-14-9-13(14)7-4-8-16-11-12-5-2-1-3-6-12/h1-3,5-6,10,13-14H,4,7-9,11H2/t13-,14+/m1/s1 |
| InChIKey | ZCGHDCPZMUCOJS-KGLIPLIRSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|