C17H22O2 — CID 100952584
[(1S,2R)-2-[(E)-2-[(1R,2S)-2-(phenylmethoxymethyl)cyclopropyl]ethenyl]cyclopropyl]methanol (PubChem CID 100952584) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is [(1S,2R)-2-[(E)-2-[(1R,2S)-2-(phenylmethoxymethyl)cyclopropyl]ethenyl]cyclopropyl]methanol.
| Compound Name | [(1S,2R)-2-[(E)-2-[(1R,2S)-2-(phenylmethoxymethyl)cyclopropyl]ethenyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 100952584 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [(1S,2R)-2-[(E)-2-[(1R,2S)-2-(phenylmethoxymethyl)cyclopropyl]ethenyl]cyclopropyl]methanol |
| SMILES | OC[C@H]1C[C@@H]1/C=C/[C@H]1C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C17H22O2/c18-10-16-8-14(16)6-7-15-9-17(15)12-19-11-13-4-2-1-3-5-13/h1-7,14-18H,8-12H2/b7-6+/t14-,15-,16+,17+/m0/s1 |
| InChIKey | CEGWQMZZUZSJNB-XJWXRQSLSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|