C36H38O5 — CID 134930284
(1R,2S,3S,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexane-1-carbaldehyde (PubChem CID 134930284) has the molecular formula C36H38O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexane-1-carbaldehyde.
| Compound Name | (1R,2S,3S,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 134930284 |
| Molecular Formula | C36H38O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (1R,2S,3S,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexane-1-carbaldehyde |
| SMILES | O=CC1C[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O5/c37-22-32-21-33(27-38-23-28-13-5-1-6-14-28)35(40-25-30-17-9-3-10-18-30)36(41-26-31-19-11-4-12-20-31)34(32)39-24-29-15-7-2-8-16-29/h1-20,22,32-36H,21,23-27H2/t32?,33-,34+,35-,36-/m1/s1 |
| InChIKey | XGNUMDKPOLGBIY-ISNVIPTDSA-N |
| XLogP | 6.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|