C35H37N3O4 — CID 10507155
[(1S,2S,3S,5R,6R)-3-azido-2,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxymethylbenzene (PubChem CID 10507155) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is [(1S,2S,3S,5R,6R)-3-azido-2,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxymethylbenzene.
| Compound Name | [(1S,2S,3S,5R,6R)-3-azido-2,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxymethylbenzene |
|---|---|
| PubChem CID | 10507155 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | [(1S,2S,3S,5R,6R)-3-azido-2,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxymethylbenzene |
| SMILES | [N-]=[N+]=N[C@H]1CC(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H37N3O4/c36-38-37-32-21-31(26-39-22-27-13-5-1-6-14-27)33(40-23-28-15-7-2-8-16-28)35(42-25-30-19-11-4-12-20-30)34(32)41-24-29-17-9-3-10-18-29/h1-20,31-35H,21-26H2/t31?,32-,33+,34-,35-/m0/s1 |
| InChIKey | MBPIKKYBFMAGHU-MWBLWTTNSA-N |
| XLogP | 7.66 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|