C12H14N6O — CID 58822158
[(3R,4R)-3,4-diazidocyclopentyl]oxymethylbenzene (PubChem CID 58822158) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is [(3R,4R)-3,4-diazidocyclopentyl]oxymethylbenzene.
| Compound Name | [(3R,4R)-3,4-diazidocyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 58822158 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(3R,4R)-3,4-diazidocyclopentyl]oxymethylbenzene |
| SMILES | [N-]=[N+]=N[C@@H]1CC(OCc2ccccc2)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H14N6O/c13-17-15-11-6-10(7-12(11)16-18-14)19-8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t11-,12-/m1/s1 |
| InChIKey | KIXODGAIZLZZAZ-VXGBXAGGSA-N |
| XLogP | 3.72 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|