C21H25N3O3S2 — CID 91229239
1-[[(1S,2S,4R)-2-azido-4-phenylmethoxycyclohexyl]methylsulfonyl]-4-methylsulfanylbenzene (PubChem CID 91229239) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-[[(1S,2S,4R)-2-azido-4-phenylmethoxycyclohexyl]methylsulfonyl]-4-methylsulfanylbenzene.
| Compound Name | 1-[[(1S,2S,4R)-2-azido-4-phenylmethoxycyclohexyl]methylsulfonyl]-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 91229239 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[[(1S,2S,4R)-2-azido-4-phenylmethoxycyclohexyl]methylsulfonyl]-4-methylsulfanylbenzene |
| SMILES | CSc1ccc(S(=O)(=O)C[C@H]2CC[C@@H](OCc3ccccc3)C[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C21H25N3O3S2/c1-28-19-9-11-20(12-10-19)29(25,26)15-17-7-8-18(13-21(17)23-24-22)27-14-16-5-3-2-4-6-16/h2-6,9-12,17-18,21H,7-8,13-15H2,1H3/t17-,18-,21+/m1/s1 |
| InChIKey | MFHGWNBAXDAHOF-OPYAIIAOSA-N |
| XLogP | 5.25 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|