C24H35N5O5S2 — CID 90896875
tert-butyl N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 90896875) has the molecular formula C24H35N5O5S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 90896875 |
| Molecular Formula | C24H35N5O5S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | tert-butyl N-[(3S)-1-[(1S,2R,4R)-4-azido-2-[(4-methylsulfanylphenyl)sulfonylmethyl]cyclohexyl]-3-methyl-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | CSc1ccc(S(=O)(=O)C[C@@H]2C[C@H](N=[N+]=[N-])CC[C@@H]2N2CC[C@](C)(NC(=O)OC(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H35N5O5S2/c1-23(2,3)34-22(31)26-24(4)12-13-29(21(24)30)20-11-6-17(27-28-25)14-16(20)15-36(32,33)19-9-7-18(35-5)8-10-19/h7-10,16-17,20H,6,11-15H2,1-5H3,(H,26,31)/t16-,17+,20-,24-/m0/s1 |
| InChIKey | OYALSNXHRMYSAW-NPGKMWDHSA-N |
| XLogP | 4.55 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|