C17H25NO4S — CID 21109996
tert-butyl N-[(1R,3S)-3-(benzenesulfonylmethyl)cyclopentyl]carbamate (PubChem CID 21109996) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-(benzenesulfonylmethyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-(benzenesulfonylmethyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 21109996 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-(benzenesulfonylmethyl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H25NO4S/c1-17(2,3)22-16(19)18-14-10-9-13(11-14)12-23(20,21)15-7-5-4-6-8-15/h4-8,13-14H,9-12H2,1-3H3,(H,18,19)/t13-,14+/m0/s1 |
| InChIKey | DENHSGCPSULVHP-UONOGXRCSA-N |
| XLogP | 3.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |