C20H32N2O4 — CID 69148440
tert-butyl N-[3-[[[dimethoxy(phenyl)methyl]amino]methyl]cyclopentyl]carbamate (PubChem CID 69148440) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[[dimethoxy(phenyl)methyl]amino]methyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-[[[dimethoxy(phenyl)methyl]amino]methyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 69148440 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl N-[3-[[[dimethoxy(phenyl)methyl]amino]methyl]cyclopentyl]carbamate |
| SMILES | COC(NCC1CCC(NC(=O)OC(C)(C)C)C1)(OC)c1ccccc1 |
| InChI | InChI=1S/C20H32N2O4/c1-19(2,3)26-18(23)22-17-12-11-15(13-17)14-21-20(24-4,25-5)16-9-7-6-8-10-16/h6-10,15,17,21H,11-14H2,1-5H3,(H,22,23) |
| InChIKey | KILHFUWPIJSTEM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|