C21H32N2O2 — CID 77144961
tert-butyl N-[4-[[(2-phenylcyclopropyl)amino]methyl]cyclohexyl]carbamate (PubChem CID 77144961) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2-phenylcyclopropyl)amino]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2-phenylcyclopropyl)amino]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 77144961 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl N-[4-[[(2-phenylcyclopropyl)amino]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CNC2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N2O2/c1-21(2,3)25-20(24)23-17-11-9-15(10-12-17)14-22-19-13-18(19)16-7-5-4-6-8-16/h4-8,15,17-19,22H,9-14H2,1-3H3,(H,23,24) |
| InChIKey | ZXFONCYPBPFEQV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |