C19H26F3NO4S — CID 67054720
tert-butyl N-[4-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexyl]carbamate (PubChem CID 67054720) has the molecular formula C19H26F3NO4S and a molecular weight of 421.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 67054720 |
| Molecular Formula | C19H26F3NO4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | tert-butyl N-[4-[[3-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CS(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26F3NO4S/c1-18(2,3)27-17(24)23-15-9-7-13(8-10-15)12-28(25,26)16-6-4-5-14(11-16)19(20,21)22/h4-6,11,13,15H,7-10,12H2,1-3H3,(H,23,24) |
| InChIKey | WDAYYDURQHWZLU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |