C17H25NO5S — CID 175606416
tert-butyl N-[1-[4-(cyclopropylmethylsulfonyl)phenyl]-2-hydroxyethyl]carbamate (PubChem CID 175606416) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(cyclopropylmethylsulfonyl)phenyl]-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(cyclopropylmethylsulfonyl)phenyl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 175606416 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | tert-butyl N-[1-[4-(cyclopropylmethylsulfonyl)phenyl]-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)c1ccc(S(=O)(=O)CC2CC2)cc1 |
| InChI | InChI=1S/C17H25NO5S/c1-17(2,3)23-16(20)18-15(10-19)13-6-8-14(9-7-13)24(21,22)11-12-4-5-12/h6-9,12,15,19H,4-5,10-11H2,1-3H3,(H,18,20) |
| InChIKey | LXZMBWZSWLXPAV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |