C16H24BrNO4 — CID 122432663
tert-butyl N-[(1R)-1-(4-bromophenyl)-4,5-dihydroxypentyl]carbamate (PubChem CID 122432663) has the molecular formula C16H24BrNO4 and a molecular weight of 374.28 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-bromophenyl)-4,5-dihydroxypentyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-bromophenyl)-4,5-dihydroxypentyl]carbamate |
|---|---|
| PubChem CID | 122432663 |
| Molecular Formula | C16H24BrNO4 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-bromophenyl)-4,5-dihydroxypentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(O)CO)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrNO4/c1-16(2,3)22-15(21)18-14(9-8-13(20)10-19)11-4-6-12(17)7-5-11/h4-7,13-14,19-20H,8-10H2,1-3H3,(H,18,21)/t13?,14-/m1/s1 |
| InChIKey | LZRBJYHXFLBGFC-ARLHGKGLSA-N |
| XLogP | 3.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |