About tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane
tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane (PubChem CID 158971973) has the molecular formula C13H20BrNO2S
and a molecular weight of 334.28 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane.
Molecular Properties
| Compound Name | tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane |
| PubChem CID | 158971973 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1.S |
| InChI | InChI=1S/C13H18BrNO2.H2S/c1-9(10-5-7-11(14)8-6-10)15-12(16)17-13(2,3)4;/h5-9H,1-4H3,(H,15,16);1H2/t9-;/m0./s1 |
| InChIKey | JNXSCNABMNFQFK-FVGYRXGTSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane?
The IUPAC name of tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane (CID 158971973) is tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane.
What is the SMILES notation for tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane?
The canonical SMILES for tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane is C[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1.S.
What is the InChIKey of tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane?
The InChIKey is JNXSCNABMNFQFK-FVGYRXGTSA-N. The full InChI is InChI=1S/C13H18BrNO2.H2S/c1-9(10-5-7-11(14)8-6-10)15-12(16)17-13(2,3)4;/h5-9H,1-4H3,(H,15,16);1H2/t9-;/m0./s1.
What are the key properties of tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane?
tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane has a molecular weight of 334.28 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;sulfane is sourced from PubChem (CID 158971973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).