C13H18ClNO2 — CID 81353770
tert-butyl N-[(1S)-1-(4-chlorophenyl)ethyl]carbamate (PubChem CID 81353770) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-chlorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 81353770 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-chlorophenyl)ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-9(10-5-7-11(14)8-6-10)15-12(16)17-13(2,3)4/h5-9H,1-4H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | NBFRMTKTEXGUEO-VIFPVBQESA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |