C14H20ClNO2 — CID 89479163
tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]carbamate (PubChem CID 89479163) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 89479163 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C14H20ClNO2/c1-10(16-13(17)18-14(2,3)4)12-7-5-11(9-15)6-8-12/h5-8,10H,9H2,1-4H3,(H,16,17) |
| InChIKey | WNIOYQBDDWKYPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|