C21H35N3O2 — CID 123928269
tert-butyl N-[1-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]ethyl]carbamate (PubChem CID 123928269) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123928269 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | tert-butyl N-[1-[4-[(4-propan-2-ylpiperazin-1-yl)methyl]phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccc(CN2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H35N3O2/c1-16(2)24-13-11-23(12-14-24)15-18-7-9-19(10-8-18)17(3)22-20(25)26-21(4,5)6/h7-10,16-17H,11-15H2,1-6H3,(H,22,25) |
| InChIKey | VEVZBXZEBCHUHM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |