C16H22BrNO3 — CID 106707193
tert-butyl 4-[1-(4-bromophenyl)ethylamino]-4-oxobutanoate (PubChem CID 106707193) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-bromophenyl)ethylamino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[1-(4-bromophenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106707193 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | tert-butyl 4-[1-(4-bromophenyl)ethylamino]-4-oxobutanoate |
| SMILES | CC(NC(=O)CCC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrNO3/c1-11(12-5-7-13(17)8-6-12)18-14(19)9-10-15(20)21-16(2,3)4/h5-8,11H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | QHRIECROKSXMPG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |