C13H16BrNO3 — CID 68866417
ethyl 3-[1-(4-bromophenyl)ethylamino]-3-oxopropanoate (PubChem CID 68866417) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is ethyl 3-[1-(4-bromophenyl)ethylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-[1-(4-bromophenyl)ethylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 68866417 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | ethyl 3-[1-(4-bromophenyl)ethylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NC(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrNO3/c1-3-18-13(17)8-12(16)15-9(2)10-4-6-11(14)7-5-10/h4-7,9H,3,8H2,1-2H3,(H,15,16) |
| InChIKey | JIWDHDGEKAAAQI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|