C20H22F3NO4 — CID 175686655
tert-butyl N-[(1R)-2-hydroxy-1-[4-[2-(trifluoromethoxy)phenyl]phenyl]ethyl]carbamate (PubChem CID 175686655) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-hydroxy-1-[4-[2-(trifluoromethoxy)phenyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-hydroxy-1-[4-[2-(trifluoromethoxy)phenyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 175686655 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | tert-butyl N-[(1R)-2-hydroxy-1-[4-[2-(trifluoromethoxy)phenyl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)c1ccc(-c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO4/c1-19(2,3)28-18(26)24-16(12-25)14-10-8-13(9-11-14)15-6-4-5-7-17(15)27-20(21,22)23/h4-11,16,25H,12H2,1-3H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | HVSLQCCGVDTNSB-INIZCTEOSA-N |
| XLogP | 4.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |