C17H26N2O6S — CID 166058461
tert-butyl N-[(1R)-1-(4-ethylsulfonylphenyl)-2-(methoxycarbonylamino)ethyl]carbamate (PubChem CID 166058461) has the molecular formula C17H26N2O6S and a molecular weight of 386.47 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-ethylsulfonylphenyl)-2-(methoxycarbonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-ethylsulfonylphenyl)-2-(methoxycarbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 166058461 |
| Molecular Formula | C17H26N2O6S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-ethylsulfonylphenyl)-2-(methoxycarbonylamino)ethyl]carbamate |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CNC(=O)OC)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O6S/c1-6-26(22,23)13-9-7-12(8-10-13)14(11-18-15(20)24-5)19-16(21)25-17(2,3)4/h7-10,14H,6,11H2,1-5H3,(H,18,20)(H,19,21)/t14-/m0/s1 |
| InChIKey | AQTLCJIIJNMTQT-AWEZNQCLSA-N |
| XLogP | 2.40 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |