C17H25NO7S — CID 87297630
ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methylsulfonyloxyphenyl)propanoate (PubChem CID 87297630) has the molecular formula C17H25NO7S and a molecular weight of 387.45 g/mol. Its IUPAC name is ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methylsulfonyloxyphenyl)propanoate.
| Compound Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methylsulfonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 87297630 |
| Molecular Formula | C17H25NO7S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methylsulfonyloxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)OC(C)(C)C)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H25NO7S/c1-6-23-15(19)11-14(18-16(20)24-17(2,3)4)12-7-9-13(10-8-12)25-26(5,21)22/h7-10,14H,6,11H2,1-5H3,(H,18,20) |
| InChIKey | CKWGNPRWMKSKED-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|