C19H29NO6 — CID 123923454
ethyl 2-[2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]acetate (PubChem CID 123923454) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is ethyl 2-[2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]acetate.
| Compound Name | ethyl 2-[2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]acetate |
|---|---|
| PubChem CID | 123923454 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | ethyl 2-[2-(4-ethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]acetate |
| SMILES | CCOC(=O)COCC(NC(=O)OC(C)(C)C)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C19H29NO6/c1-6-24-15-10-8-14(9-11-15)16(12-23-13-17(21)25-7-2)20-18(22)26-19(3,4)5/h8-11,16H,6-7,12-13H2,1-5H3,(H,20,22) |
| InChIKey | QMDRWADZXMQZDA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |