C18H25NO5 — CID 91612546
ethyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5-phenylpentanoate (PubChem CID 91612546) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5-phenylpentanoate.
| Compound Name | ethyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 91612546 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethyl (5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5-phenylpentanoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO5/c1-5-23-16(21)12-14(20)11-15(13-9-7-6-8-10-13)19-17(22)24-18(2,3)4/h6-10,15H,5,11-12H2,1-4H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | AZWBEXMGYGCRHB-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|