C21H25NO2 — CID 162418431
tert-butyl N-[(1R)-1,3-diphenylbut-3-enyl]carbamate (PubChem CID 162418431) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1,3-diphenylbut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1,3-diphenylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 162418431 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl N-[(1R)-1,3-diphenylbut-3-enyl]carbamate |
| SMILES | C=C(C[C@@H](NC(=O)OC(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-16(17-11-7-5-8-12-17)15-19(18-13-9-6-10-14-18)22-20(23)24-21(2,3)4/h5-14,19H,1,15H2,2-4H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | HMJLYYXWTKQJBP-LJQANCHMSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |