C19H29NO4 — CID 14003425
ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoate (PubChem CID 14003425) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoate.
| Compound Name | ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoate |
|---|---|
| PubChem CID | 14003425 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | ethyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhexanoate |
| SMILES | CCOC(=O)CCCCC(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-23-17(21)14-10-9-13-16(15-11-7-6-8-12-15)20-18(22)24-19(2,3)4/h6-8,11-12,16H,5,9-10,13-14H2,1-4H3,(H,20,22) |
| InChIKey | CFGAIAOFWDYTAN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|