C19H27NO3 — CID 176531261
ethyl 4-[1-[(2-methylpropan-2-yl)oxy]propa-1,2-dienylamino]-4-phenylbutanoate (PubChem CID 176531261) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is ethyl 4-[1-[(2-methylpropan-2-yl)oxy]propa-1,2-dienylamino]-4-phenylbutanoate.
| Compound Name | ethyl 4-[1-[(2-methylpropan-2-yl)oxy]propa-1,2-dienylamino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 176531261 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | ethyl 4-[1-[(2-methylpropan-2-yl)oxy]propa-1,2-dienylamino]-4-phenylbutanoate |
| SMILES | C=C=C(NC(CCC(=O)OCC)c1ccccc1)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO3/c1-6-17(23-19(3,4)5)20-16(13-14-18(21)22-7-2)15-11-9-8-10-12-15/h8-12,16,20H,1,7,13-14H2,2-5H3 |
| InChIKey | CTSBMGWJATVZOH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|