C15H22N4O2 — CID 86590308
tert-butyl N-(4-azido-1-phenylbutyl)carbamate (PubChem CID 86590308) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is tert-butyl N-(4-azido-1-phenylbutyl)carbamate.
| Compound Name | tert-butyl N-(4-azido-1-phenylbutyl)carbamate |
|---|---|
| PubChem CID | 86590308 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl N-(4-azido-1-phenylbutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCN=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)21-14(20)18-13(10-7-11-17-19-16)12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3,(H,18,20) |
| InChIKey | WESPWGMSUYXZLI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|