C21H25NO7S — CID 23034284
3-[4-(4-methylphenyl)sulfonyloxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 23034284) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-[4-(4-methylphenyl)sulfonyloxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-[4-(4-methylphenyl)sulfonyloxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 23034284 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[4-(4-methylphenyl)sulfonyloxyphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(CC(=O)O)NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H25NO7S/c1-14-5-11-17(12-6-14)30(26,27)29-16-9-7-15(8-10-16)18(13-19(23)24)22-20(25)28-21(2,3)4/h5-12,18H,13H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | MQPLNTDVDYKXPV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|