C26H35NO7S — CID 87297723
ditert-butyl 2-(aminomethyl)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate (PubChem CID 87297723) has the molecular formula C26H35NO7S and a molecular weight of 505.63 g/mol. Its IUPAC name is ditert-butyl 2-(aminomethyl)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate.
| Compound Name | ditert-butyl 2-(aminomethyl)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate |
|---|---|
| PubChem CID | 87297723 |
| Molecular Formula | C26H35NO7S |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | ditert-butyl 2-(aminomethyl)-3-[4-(4-methylphenyl)sulfonyloxyphenyl]butanedioate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C(=O)OC(C)(C)C)C(CN)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H35NO7S/c1-17-8-14-20(15-9-17)35(30,31)34-19-12-10-18(11-13-19)22(24(29)33-26(5,6)7)21(16-27)23(28)32-25(2,3)4/h8-15,21-22H,16,27H2,1-7H3 |
| InChIKey | NODCMVVQFXADDW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|