C17H18O5S — CID 87296864
methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate (PubChem CID 87296864) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate.
| Compound Name | methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 87296864 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 2-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoate |
| SMILES | COC(=O)C(C)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H18O5S/c1-12-4-10-16(11-5-12)23(19,20)22-15-8-6-14(7-9-15)13(2)17(18)21-3/h4-11,13H,1-3H3 |
| InChIKey | GXYHFNUGOJGICA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|