C21H17F3O4S — CID 102123720
[4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 102123720) has the molecular formula C21H17F3O4S and a molecular weight of 422.42 g/mol. Its IUPAC name is [4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102123720 |
| Molecular Formula | C21H17F3O4S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [4-[4-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]phenyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(-c3ccc([C@@H](O)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H17F3O4S/c1-14-2-12-19(13-3-14)29(26,27)28-18-10-8-16(9-11-18)15-4-6-17(7-5-15)20(25)21(22,23)24/h2-13,20,25H,1H3/t20-/m1/s1 |
| InChIKey | OVWLOMIHVGXHCY-HXUWFJFHSA-N |
| XLogP | 5.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|