C16H17NO4S — CID 87297484
[4-(1-amino-1-oxopropan-2-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 87297484) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is [4-(1-amino-1-oxopropan-2-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(1-amino-1-oxopropan-2-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87297484 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | [4-(1-amino-1-oxopropan-2-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(C)C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-11-3-9-15(10-4-11)22(19,20)21-14-7-5-13(6-8-14)12(2)16(17)18/h3-10,12H,1-2H3,(H2,17,18) |
| InChIKey | YLVXZGRLOJBBCA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|