C14H13NO5S — CID 46895395
(3-carbamoyl-4-hydroxyphenyl) 4-methylbenzenesulfonate (PubChem CID 46895395) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is (3-carbamoyl-4-hydroxyphenyl) 4-methylbenzenesulfonate.
| Compound Name | (3-carbamoyl-4-hydroxyphenyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46895395 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (3-carbamoyl-4-hydroxyphenyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(O)c(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C14H13NO5S/c1-9-2-5-11(6-3-9)21(18,19)20-10-4-7-13(16)12(8-10)14(15)17/h2-8,16H,1H3,(H2,15,17) |
| InChIKey | CAVZUPJBJDJEFY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|