C17H18O3S — CID 10494583
5,6,7,8-tetrahydronaphthalen-2-yl 4-methylbenzenesulfonate (PubChem CID 10494583) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl 4-methylbenzenesulfonate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10494583 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C17H18O3S/c1-13-6-10-17(11-7-13)21(18,19)20-16-9-8-14-4-2-3-5-15(14)12-16/h6-12H,2-5H2,1H3 |
| InChIKey | AGZRICGLPUCUSA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|