C16H15NO4S — CID 18148740
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-methylbenzenesulfonate (PubChem CID 18148740) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 18148740 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C16H15NO4S/c1-11-2-6-14(7-3-11)22(19,20)21-13-5-8-15-12(10-13)4-9-16(18)17-15/h2-3,5-8,10H,4,9H2,1H3,(H,17,18) |
| InChIKey | DLOSHWZUGCWLEY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|