C15H11F2NO4S — CID 18148741
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2,4-difluorobenzenesulfonate (PubChem CID 18148741) has the molecular formula C15H11F2NO4S and a molecular weight of 339.32 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2,4-difluorobenzenesulfonate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2,4-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 18148741 |
| Molecular Formula | C15H11F2NO4S |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2,4-difluorobenzenesulfonate |
| SMILES | O=C1CCc2cc(OS(=O)(=O)c3ccc(F)cc3F)ccc2N1 |
| InChI | InChI=1S/C15H11F2NO4S/c16-10-2-5-14(12(17)8-10)23(20,21)22-11-3-4-13-9(7-11)1-6-15(19)18-13/h2-5,7-8H,1,6H2,(H,18,19) |
| InChIKey | VVBXEURPQYSFCH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|