C9H9FN2O3S — CID 47213624
7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 47213624) has the molecular formula C9H9FN2O3S and a molecular weight of 244.25 g/mol. Its IUPAC name is 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 47213624 |
| Molecular Formula | C9H9FN2O3S |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C9H9FN2O3S/c10-6-4-7-5(1-2-9(13)12-7)3-8(6)16(11,14)15/h3-4H,1-2H2,(H,12,13)(H2,11,14,15) |
| InChIKey | CXCUMUUJNZIRGK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |