C10H9ClFNO — CID 43457700
6-(chloromethyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43457700) has the molecular formula C10H9ClFNO and a molecular weight of 213.64 g/mol. Its IUPAC name is 6-(chloromethyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(chloromethyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43457700 |
| Molecular Formula | C10H9ClFNO |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 6-(chloromethyl)-7-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CCl)c(F)cc2N1 |
| InChI | InChI=1S/C10H9ClFNO/c11-5-7-3-6-1-2-10(14)13-9(6)4-8(7)12/h3-4H,1-2,5H2,(H,13,14) |
| InChIKey | UKUGIOLNOKJGTF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|