C10H10FNO — CID 70647760
5-ethyl-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 70647760) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 5-ethyl-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 5-ethyl-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 70647760 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-ethyl-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCc1cc2c(cc1F)NC(=O)C2 |
| InChI | InChI=1S/C10H10FNO/c1-2-6-3-7-4-10(13)12-9(7)5-8(6)11/h3,5H,2,4H2,1H3,(H,12,13) |
| InChIKey | MHEJDYQGABKEKW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |