About N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide
N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide (PubChem CID 66607967) has the molecular formula C11H11FN2O3
and a molecular weight of 238.22 g/mol. Its IUPAC name is N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide.
Molecular Properties
| Compound Name | N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide |
| PubChem CID | 66607967 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)Nc1cc2c(cc1F)CC(=O)N2 |
| InChI | InChI=1S/C11H11FN2O3/c1-5(15)11(17)14-9-4-8-6(2-7(9)12)3-10(16)13-8/h2,4-5,15H,3H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | YXCONAFZMNQVJP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide?
The IUPAC name of N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide (CID 66607967) is N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide.
What is the SMILES notation for N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide?
The canonical SMILES for N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide is CC(O)C(=O)Nc1cc2c(cc1F)CC(=O)N2.
What is the InChIKey of N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide?
The InChIKey is YXCONAFZMNQVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O3/c1-5(15)11(17)14-9-4-8-6(2-7(9)12)3-10(16)13-8/h2,4-5,15H,3H2,1H3,(H,13,16)(H,14,17).
What are the key properties of N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide?
N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide has a molecular weight of 238.22 g/mol, XLogP of 0.64, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-2-oxo-1,3-dihydroindol-6-yl)-2-hydroxypropanamide is sourced from PubChem (CID 66607967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).