C8H7FN2O — CID 10103504
6-amino-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 10103504) has the molecular formula C8H7FN2O and a molecular weight of 166.16 g/mol. Its IUPAC name is 6-amino-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 6-amino-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 10103504 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 6-amino-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1F)CC(=O)N2 |
| InChI | InChI=1S/C8H7FN2O/c9-5-1-4-2-8(12)11-7(4)3-6(5)10/h1,3H,2,10H2,(H,11,12) |
| InChIKey | ARQRWWOHJBWWKT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|