C14H10F3N3O — CID 62808776
5-amino-6-(2,3,5-trifluoroanilino)-1,3-dihydroindol-2-one (PubChem CID 62808776) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is 5-amino-6-(2,3,5-trifluoroanilino)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(2,3,5-trifluoroanilino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62808776 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-amino-6-(2,3,5-trifluoroanilino)-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1Nc1cc(F)cc(F)c1F)NC(=O)C2 |
| InChI | InChI=1S/C14H10F3N3O/c15-7-3-8(16)14(17)12(4-7)19-11-5-10-6(1-9(11)18)2-13(21)20-10/h1,3-5,19H,2,18H2,(H,20,21) |
| InChIKey | WFOIAUNWCMGGLP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|