C16H18N4O — CID 106759462
5-amino-6-[2-(dimethylamino)anilino]-1,3-dihydroindol-2-one (PubChem CID 106759462) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-amino-6-[2-(dimethylamino)anilino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[2-(dimethylamino)anilino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106759462 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-amino-6-[2-(dimethylamino)anilino]-1,3-dihydroindol-2-one |
| SMILES | CN(C)c1ccccc1Nc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C16H18N4O/c1-20(2)15-6-4-3-5-12(15)18-14-9-13-10(7-11(14)17)8-16(21)19-13/h3-7,9,18H,8,17H2,1-2H3,(H,19,21) |
| InChIKey | QKPKOBRPYCGISK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|