C15H11BrN4O — CID 107797097
2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-4-bromobenzonitrile (PubChem CID 107797097) has the molecular formula C15H11BrN4O and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-4-bromobenzonitrile.
| Compound Name | 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 107797097 |
| Molecular Formula | C15H11BrN4O |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1Nc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C15H11BrN4O/c16-10-2-1-8(7-17)12(5-10)19-14-6-13-9(3-11(14)18)4-15(21)20-13/h1-3,5-6,19H,4,18H2,(H,20,21) |
| InChIKey | IIMIJDVRQSULSO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|