C16H16BrN3O — CID 43805901
7-amino-6-(5-bromo-2-methylanilino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43805901) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is 7-amino-6-(5-bromo-2-methylanilino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-amino-6-(5-bromo-2-methylanilino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43805901 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 7-amino-6-(5-bromo-2-methylanilino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc(Br)cc1Nc1cc2c(cc1N)NC(=O)CC2 |
| InChI | InChI=1S/C16H16BrN3O/c1-9-2-4-11(17)7-13(9)19-15-6-10-3-5-16(21)20-14(10)8-12(15)18/h2,4,6-8,19H,3,5,18H2,1H3,(H,20,21) |
| InChIKey | QISYKNZVLARUPD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|